About lithium;2-sulfobenzoic acid;chloride
lithium;2-sulfobenzoic acid;chloride (PubChem CID 87872456) has the molecular formula C7H6ClLiO5S
and a molecular weight of 244.58 g/mol. Its IUPAC name is lithium;2-sulfobenzoic acid;chloride.
Molecular Properties
| Compound Name | lithium;2-sulfobenzoic acid;chloride |
| PubChem CID | 87872456 |
| Molecular Formula | C7H6ClLiO5S |
| Molecular Weight | 244.58 g/mol |
| Exact Mass | 243.98 |
| IUPAC Name | lithium;2-sulfobenzoic acid;chloride |
| SMILES | O=C(O)c1ccccc1S(=O)(=O)O.[Cl-].[Li+] |
| InChI | InChI=1S/C7H6O5S.ClH.Li/c8-7(9)5-3-1-2-4-6(5)13(10,11)12;;/h1-4H,(H,8,9)(H,10,11,12);1H;/q;;+1/p-1 |
| InChIKey | CUCQYFIWBTYXGY-UHFFFAOYSA-M |
| XLogP | -5.36 |
| TPSA | 91.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 244.58 |
| LogP ≤ 5 | -5.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|
Analyze lithium;2-sulfobenzoic acid;chloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of lithium;2-sulfobenzoic acid;chloride?
The IUPAC name of lithium;2-sulfobenzoic acid;chloride (CID 87872456) is lithium;2-sulfobenzoic acid;chloride.
What is the SMILES notation for lithium;2-sulfobenzoic acid;chloride?
The canonical SMILES for lithium;2-sulfobenzoic acid;chloride is O=C(O)c1ccccc1S(=O)(=O)O.[Cl-].[Li+].
What is the InChIKey of lithium;2-sulfobenzoic acid;chloride?
The InChIKey is CUCQYFIWBTYXGY-UHFFFAOYSA-M. The full InChI is InChI=1S/C7H6O5S.ClH.Li/c8-7(9)5-3-1-2-4-6(5)13(10,11)12;;/h1-4H,(H,8,9)(H,10,11,12);1H;/q;;+1/p-1.
What are the key properties of lithium;2-sulfobenzoic acid;chloride?
lithium;2-sulfobenzoic acid;chloride has a molecular weight of 244.58 g/mol, XLogP of -5.36, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for lithium;2-sulfobenzoic acid;chloride is sourced from PubChem (CID 87872456), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).