C16H16O7S — CID 174517253
2-methylbenzene-1,3-dicarboxylic acid;2-methylbenzenesulfonic acid (PubChem CID 174517253) has the molecular formula C16H16O7S and a molecular weight of 352.36 g/mol. Its IUPAC name is 2-methylbenzene-1,3-dicarboxylic acid;2-methylbenzenesulfonic acid.
| Compound Name | 2-methylbenzene-1,3-dicarboxylic acid;2-methylbenzenesulfonic acid |
|---|---|
| PubChem CID | 174517253 |
| Molecular Formula | C16H16O7S |
| Molecular Weight | 352.36 g/mol |
| Exact Mass | 352.06 |
| IUPAC Name | 2-methylbenzene-1,3-dicarboxylic acid;2-methylbenzenesulfonic acid |
| SMILES | Cc1c(C(=O)O)cccc1C(=O)O.Cc1ccccc1S(=O)(=O)O |
| InChI | InChI=1S/C9H8O4.C7H8O3S/c1-5-6(8(10)11)3-2-4-7(5)9(12)13;1-6-4-2-3-5-7(6)11(8,9)10/h2-4H,1H3,(H,10,11)(H,12,13);2-5H,1H3,(H,8,9,10) |
| InChIKey | XYTSEWWGFMGZLC-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 128.97 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.36 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|