About 2-methylbenzenesulfonic acid;nickel
2-methylbenzenesulfonic acid;nickel (PubChem CID 174250296) has the molecular formula C7H8NiO3S
and a molecular weight of 230.90 g/mol. Its IUPAC name is 2-methylbenzenesulfonic acid;nickel.
Molecular Properties
| Compound Name | 2-methylbenzenesulfonic acid;nickel |
| PubChem CID | 174250296 |
| Molecular Formula | C7H8NiO3S |
| Molecular Weight | 230.90 g/mol |
| Exact Mass | 229.95 |
| IUPAC Name | 2-methylbenzenesulfonic acid;nickel |
| SMILES | Cc1ccccc1S(=O)(=O)O.[Ni] |
| InChI | InChI=1S/C7H8O3S.Ni/c1-6-4-2-3-5-7(6)11(8,9)10;/h2-5H,1H3,(H,8,9,10); |
| InChIKey | PHSZACGGGKQWMH-UHFFFAOYSA-N |
| XLogP | 1.24 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 230.90 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|
Analyze 2-methylbenzenesulfonic acid;nickel with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methylbenzenesulfonic acid;nickel?
The IUPAC name of 2-methylbenzenesulfonic acid;nickel (CID 174250296) is 2-methylbenzenesulfonic acid;nickel.
What is the SMILES notation for 2-methylbenzenesulfonic acid;nickel?
The canonical SMILES for 2-methylbenzenesulfonic acid;nickel is Cc1ccccc1S(=O)(=O)O.[Ni].
What is the InChIKey of 2-methylbenzenesulfonic acid;nickel?
The InChIKey is PHSZACGGGKQWMH-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H8O3S.Ni/c1-6-4-2-3-5-7(6)11(8,9)10;/h2-5H,1H3,(H,8,9,10);.
What are the key properties of 2-methylbenzenesulfonic acid;nickel?
2-methylbenzenesulfonic acid;nickel has a molecular weight of 230.90 g/mol, XLogP of 1.24, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methylbenzenesulfonic acid;nickel is sourced from PubChem (CID 174250296), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).