About 2-methylbenzenesulfonic acid;prop-1-ene
2-methylbenzenesulfonic acid;prop-1-ene (PubChem CID 174326125) has the molecular formula C10H14O3S
and a molecular weight of 214.29 g/mol. Its IUPAC name is 2-methylbenzenesulfonic acid;prop-1-ene.
Molecular Properties
| Compound Name | 2-methylbenzenesulfonic acid;prop-1-ene |
| PubChem CID | 174326125 |
| Molecular Formula | C10H14O3S |
| Molecular Weight | 214.29 g/mol |
| Exact Mass | 214.07 |
| IUPAC Name | 2-methylbenzenesulfonic acid;prop-1-ene |
| SMILES | C=CC.Cc1ccccc1S(=O)(=O)O |
| InChI | InChI=1S/C7H8O3S.C3H6/c1-6-4-2-3-5-7(6)11(8,9)10;1-3-2/h2-5H,1H3,(H,8,9,10);3H,1H2,2H3 |
| InChIKey | KNBDGWNVRHTKCA-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 214.29 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|
Analyze 2-methylbenzenesulfonic acid;prop-1-ene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methylbenzenesulfonic acid;prop-1-ene?
The IUPAC name of 2-methylbenzenesulfonic acid;prop-1-ene (CID 174326125) is 2-methylbenzenesulfonic acid;prop-1-ene.
What is the SMILES notation for 2-methylbenzenesulfonic acid;prop-1-ene?
The canonical SMILES for 2-methylbenzenesulfonic acid;prop-1-ene is C=CC.Cc1ccccc1S(=O)(=O)O.
What is the InChIKey of 2-methylbenzenesulfonic acid;prop-1-ene?
The InChIKey is KNBDGWNVRHTKCA-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H8O3S.C3H6/c1-6-4-2-3-5-7(6)11(8,9)10;1-3-2/h2-5H,1H3,(H,8,9,10);3H,1H2,2H3.
What are the key properties of 2-methylbenzenesulfonic acid;prop-1-ene?
2-methylbenzenesulfonic acid;prop-1-ene has a molecular weight of 214.29 g/mol, XLogP of 2.43, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methylbenzenesulfonic acid;prop-1-ene is sourced from PubChem (CID 174326125), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).