About magnesium bis(2-sulfobenzoate)
magnesium bis(2-sulfobenzoate) (PubChem CID 141193251) has the molecular formula C14H10MgO10S2
and a molecular weight of 426.66 g/mol. Its IUPAC name is magnesium bis(2-sulfobenzoate).
Molecular Properties
| Compound Name | magnesium bis(2-sulfobenzoate) |
| PubChem CID | 141193251 |
| Molecular Formula | C14H10MgO10S2 |
| Molecular Weight | 426.66 g/mol |
| Exact Mass | 425.96 |
| IUPAC Name | magnesium bis(2-sulfobenzoate) |
| SMILES | O=C([O-])c1ccccc1S(=O)(=O)O.O=C([O-])c1ccccc1S(=O)(=O)O.[Mg+2] |
| InChI | InChI=1S/2C7H6O5S.Mg/c2*8-7(9)5-3-1-2-4-6(5)13(10,11)12;/h2*1-4H,(H,8,9)(H,10,11,12);/q;;+2/p-2 |
| InChIKey | JACIQPRZIYXYEG-UHFFFAOYSA-L |
| XLogP | -1.79 |
| TPSA | 189.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 426.66 |
| LogP ≤ 5 | -1.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|
Analyze magnesium bis(2-sulfobenzoate) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of magnesium bis(2-sulfobenzoate)?
The IUPAC name of magnesium bis(2-sulfobenzoate) (CID 141193251) is magnesium bis(2-sulfobenzoate).
What is the SMILES notation for magnesium bis(2-sulfobenzoate)?
The canonical SMILES for magnesium bis(2-sulfobenzoate) is O=C([O-])c1ccccc1S(=O)(=O)O.O=C([O-])c1ccccc1S(=O)(=O)O.[Mg+2].
What is the InChIKey of magnesium bis(2-sulfobenzoate)?
The InChIKey is JACIQPRZIYXYEG-UHFFFAOYSA-L. The full InChI is InChI=1S/2C7H6O5S.Mg/c2*8-7(9)5-3-1-2-4-6(5)13(10,11)12;/h2*1-4H,(H,8,9)(H,10,11,12);/q;;+2/p-2.
What are the key properties of magnesium bis(2-sulfobenzoate)?
magnesium bis(2-sulfobenzoate) has a molecular weight of 426.66 g/mol, XLogP of -1.79, 4 rotatable bonds, 2 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for magnesium bis(2-sulfobenzoate) is sourced from PubChem (CID 141193251), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).