About 4-sulfobenzene-1,3-dicarboxylate
4-sulfobenzene-1,3-dicarboxylate (PubChem CID 22460158) has the molecular formula C8H4O7S-2
and a molecular weight of 244.18 g/mol. Its IUPAC name is 4-sulfobenzene-1,3-dicarboxylate.
Molecular Properties
| Compound Name | 4-sulfobenzene-1,3-dicarboxylate |
| PubChem CID | 22460158 |
| Molecular Formula | C8H4O7S-2 |
| Molecular Weight | 244.18 g/mol |
| Exact Mass | 243.97 |
| IUPAC Name | 4-sulfobenzene-1,3-dicarboxylate |
| SMILES | O=C([O-])c1ccc(S(=O)(=O)O)c(C(=O)[O-])c1 |
| InChI | InChI=1S/C8H6O7S/c9-7(10)4-1-2-6(16(13,14)15)5(3-4)8(11)12/h1-3H,(H,9,10)(H,11,12)(H,13,14,15)/p-2 |
| InChIKey | JSYUFUJLFRBMEN-UHFFFAOYSA-L |
| XLogP | -2.34 |
| TPSA | 134.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 244.18 |
| LogP ≤ 5 | -2.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|
Analyze 4-sulfobenzene-1,3-dicarboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-sulfobenzene-1,3-dicarboxylate?
The IUPAC name of 4-sulfobenzene-1,3-dicarboxylate (CID 22460158) is 4-sulfobenzene-1,3-dicarboxylate.
What is the SMILES notation for 4-sulfobenzene-1,3-dicarboxylate?
The canonical SMILES for 4-sulfobenzene-1,3-dicarboxylate is O=C([O-])c1ccc(S(=O)(=O)O)c(C(=O)[O-])c1.
What is the InChIKey of 4-sulfobenzene-1,3-dicarboxylate?
The InChIKey is JSYUFUJLFRBMEN-UHFFFAOYSA-L. The full InChI is InChI=1S/C8H6O7S/c9-7(10)4-1-2-6(16(13,14)15)5(3-4)8(11)12/h1-3H,(H,9,10)(H,11,12)(H,13,14,15)/p-2.
What are the key properties of 4-sulfobenzene-1,3-dicarboxylate?
4-sulfobenzene-1,3-dicarboxylate has a molecular weight of 244.18 g/mol, XLogP of -2.34, 3 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 4-sulfobenzene-1,3-dicarboxylate is sourced from PubChem (CID 22460158), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).