C16H8NaO11S-3 — CID 18349951
sodium;2-sulfobenzene-1,3-dicarboxylate;terephthalate (PubChem CID 18349951) has the molecular formula C16H8NaO11S-3 and a molecular weight of 431.29 g/mol. Its IUPAC name is sodium;2-sulfobenzene-1,3-dicarboxylate;terephthalate.
| Compound Name | sodium;2-sulfobenzene-1,3-dicarboxylate;terephthalate |
|---|---|
| PubChem CID | 18349951 |
| Molecular Formula | C16H8NaO11S-3 |
| Molecular Weight | 431.29 g/mol |
| Exact Mass | 430.97 |
| IUPAC Name | sodium;2-sulfobenzene-1,3-dicarboxylate;terephthalate |
| SMILES | O=C([O-])c1ccc(C(=O)[O-])cc1.O=C([O-])c1cccc(C(=O)[O-])c1S(=O)(=O)O.[Na+] |
| InChI | InChI=1S/C8H6O7S.C8H6O4.Na/c9-7(10)4-2-1-3-5(8(11)12)6(4)16(13,14)15;9-7(10)5-1-2-6(4-3-5)8(11)12;/h1-3H,(H,9,10)(H,11,12)(H,13,14,15);1-4H,(H,9,10)(H,11,12);/q;;+1/p-4 |
| InChIKey | VRNMSJWEKJSJDS-UHFFFAOYSA-J |
| XLogP | -6.92 |
| TPSA | 214.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.29 |
| LogP ≤ 5 | -6.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|