About terephthalate;vanadium(4+)
terephthalate;vanadium(4+) (PubChem CID 157213578) has the molecular formula C16H8O8V
and a molecular weight of 379.18 g/mol. Its IUPAC name is terephthalate;vanadium(4+).
Molecular Properties
| Compound Name | terephthalate;vanadium(4+) |
| PubChem CID | 157213578 |
| Molecular Formula | C16H8O8V |
| Molecular Weight | 379.18 g/mol |
| Exact Mass | 378.97 |
| IUPAC Name | terephthalate;vanadium(4+) |
| SMILES | O=C([O-])c1ccc(C(=O)[O-])cc1.O=C([O-])c1ccc(C(=O)[O-])cc1.[V+4] |
| InChI | InChI=1S/2C8H6O4.V/c2*9-7(10)5-1-2-6(4-3-5)8(11)12;/h2*1-4H,(H,9,10)(H,11,12);/q;;+4/p-4 |
| InChIKey | ASDVBNNPHPRWJY-UHFFFAOYSA-J |
| XLogP | -3.18 |
| TPSA | 160.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 379.18 |
| LogP ≤ 5 | -3.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
Analyze terephthalate;vanadium(4+) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of terephthalate;vanadium(4+)?
The IUPAC name of terephthalate;vanadium(4+) (CID 157213578) is terephthalate;vanadium(4+).
What is the SMILES notation for terephthalate;vanadium(4+)?
The canonical SMILES for terephthalate;vanadium(4+) is O=C([O-])c1ccc(C(=O)[O-])cc1.O=C([O-])c1ccc(C(=O)[O-])cc1.[V+4].
What is the InChIKey of terephthalate;vanadium(4+)?
The InChIKey is ASDVBNNPHPRWJY-UHFFFAOYSA-J. The full InChI is InChI=1S/2C8H6O4.V/c2*9-7(10)5-1-2-6(4-3-5)8(11)12;/h2*1-4H,(H,9,10)(H,11,12);/q;;+4/p-4.
What are the key properties of terephthalate;vanadium(4+)?
terephthalate;vanadium(4+) has a molecular weight of 379.18 g/mol, XLogP of -3.18, 4 rotatable bonds, 0 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for terephthalate;vanadium(4+) is sourced from PubChem (CID 157213578), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).