About bis(propan-2-olate);terephthalate;titanium(4+)
bis(propan-2-olate);terephthalate;titanium(4+) (PubChem CID 158702932) has the molecular formula C14H18O6Ti
and a molecular weight of 330.16 g/mol. Its IUPAC name is bis(propan-2-olate);terephthalate;titanium(4+).
Molecular Properties
| Compound Name | bis(propan-2-olate);terephthalate;titanium(4+) |
| PubChem CID | 158702932 |
| Molecular Formula | C14H18O6Ti |
| Molecular Weight | 330.16 g/mol |
| Exact Mass | 330.06 |
| IUPAC Name | bis(propan-2-olate);terephthalate;titanium(4+) |
| SMILES | CC(C)[O-].CC(C)[O-].O=C([O-])c1ccc(C(=O)[O-])cc1.[Ti+4] |
| InChI | InChI=1S/C8H6O4.2C3H7O.Ti/c9-7(10)5-1-2-6(4-3-5)8(11)12;2*1-3(2)4;/h1-4H,(H,9,10)(H,11,12);2*3H,1-2H3;/q;2*-1;+4/p-2 |
| InChIKey | IHTQRAGDHDNQGF-UHFFFAOYSA-L |
| XLogP | -2.08 |
| TPSA | 126.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 330.16 |
| LogP ≤ 5 | -2.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze bis(propan-2-olate);terephthalate;titanium(4+) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis(propan-2-olate);terephthalate;titanium(4+)?
The IUPAC name of bis(propan-2-olate);terephthalate;titanium(4+) (CID 158702932) is bis(propan-2-olate);terephthalate;titanium(4+).
What is the SMILES notation for bis(propan-2-olate);terephthalate;titanium(4+)?
The canonical SMILES for bis(propan-2-olate);terephthalate;titanium(4+) is CC(C)[O-].CC(C)[O-].O=C([O-])c1ccc(C(=O)[O-])cc1.[Ti+4].
What is the InChIKey of bis(propan-2-olate);terephthalate;titanium(4+)?
The InChIKey is IHTQRAGDHDNQGF-UHFFFAOYSA-L. The full InChI is InChI=1S/C8H6O4.2C3H7O.Ti/c9-7(10)5-1-2-6(4-3-5)8(11)12;2*1-3(2)4;/h1-4H,(H,9,10)(H,11,12);2*3H,1-2H3;/q;2*-1;+4/p-2.
What are the key properties of bis(propan-2-olate);terephthalate;titanium(4+)?
bis(propan-2-olate);terephthalate;titanium(4+) has a molecular weight of 330.16 g/mol, XLogP of -2.08, 2 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for bis(propan-2-olate);terephthalate;titanium(4+) is sourced from PubChem (CID 158702932), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).