About azanium;sodium;terephthalate
azanium;sodium;terephthalate (PubChem CID 18352242) has the molecular formula C8H8NNaO4
and a molecular weight of 205.15 g/mol. Its IUPAC name is azanium;sodium;terephthalate.
Molecular Properties
| Compound Name | azanium;sodium;terephthalate |
| PubChem CID | 18352242 |
| Molecular Formula | C8H8NNaO4 |
| Molecular Weight | 205.15 g/mol |
| Exact Mass | 205.04 |
| IUPAC Name | azanium;sodium;terephthalate |
| SMILES | O=C([O-])c1ccc(C(=O)[O-])cc1.[NH4+].[Na+] |
| InChI | InChI=1S/C8H6O4.H3N.Na/c9-7(10)5-1-2-6(4-3-5)8(11)12;;/h1-4H,(H,9,10)(H,11,12);1H3;/q;;+1/p-1 |
| InChIKey | VJEOMIKUHAWURI-UHFFFAOYSA-M |
| XLogP | -4.21 |
| TPSA | 116.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 205.15 |
| LogP ≤ 5 | -4.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze azanium;sodium;terephthalate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of azanium;sodium;terephthalate?
The IUPAC name of azanium;sodium;terephthalate (CID 18352242) is azanium;sodium;terephthalate.
What is the SMILES notation for azanium;sodium;terephthalate?
The canonical SMILES for azanium;sodium;terephthalate is O=C([O-])c1ccc(C(=O)[O-])cc1.[NH4+].[Na+].
What is the InChIKey of azanium;sodium;terephthalate?
The InChIKey is VJEOMIKUHAWURI-UHFFFAOYSA-M. The full InChI is InChI=1S/C8H6O4.H3N.Na/c9-7(10)5-1-2-6(4-3-5)8(11)12;;/h1-4H,(H,9,10)(H,11,12);1H3;/q;;+1/p-1.
What are the key properties of azanium;sodium;terephthalate?
azanium;sodium;terephthalate has a molecular weight of 205.15 g/mol, XLogP of -4.21, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for azanium;sodium;terephthalate is sourced from PubChem (CID 18352242), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).