About disodium;ethene;terephthalate
disodium;ethene;terephthalate (PubChem CID 175257755) has the molecular formula C10H8Na2O4
and a molecular weight of 238.15 g/mol. Its IUPAC name is disodium;ethene;terephthalate.
Molecular Properties
| Compound Name | disodium;ethene;terephthalate |
| PubChem CID | 175257755 |
| Molecular Formula | C10H8Na2O4 |
| Molecular Weight | 238.15 g/mol |
| Exact Mass | 238.02 |
| IUPAC Name | disodium;ethene;terephthalate |
| SMILES | C=C.O=C([O-])c1ccc(C(=O)[O-])cc1.[Na+].[Na+] |
| InChI | InChI=1S/C8H6O4.C2H4.2Na/c9-7(10)5-1-2-6(4-3-5)8(11)12;1-2;;/h1-4H,(H,9,10)(H,11,12);1-2H2;;/q;;2*+1/p-2 |
| InChIKey | WXXQCSHEGLUCNI-UHFFFAOYSA-L |
| XLogP | -6.78 |
| TPSA | 80.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 238.15 |
| LogP ≤ 5 | -6.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze disodium;ethene;terephthalate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of disodium;ethene;terephthalate?
The IUPAC name of disodium;ethene;terephthalate (CID 175257755) is disodium;ethene;terephthalate.
What is the SMILES notation for disodium;ethene;terephthalate?
The canonical SMILES for disodium;ethene;terephthalate is C=C.O=C([O-])c1ccc(C(=O)[O-])cc1.[Na+].[Na+].
What is the InChIKey of disodium;ethene;terephthalate?
The InChIKey is WXXQCSHEGLUCNI-UHFFFAOYSA-L. The full InChI is InChI=1S/C8H6O4.C2H4.2Na/c9-7(10)5-1-2-6(4-3-5)8(11)12;1-2;;/h1-4H,(H,9,10)(H,11,12);1-2H2;;/q;;2*+1/p-2.
What are the key properties of disodium;ethene;terephthalate?
disodium;ethene;terephthalate has a molecular weight of 238.15 g/mol, XLogP of -6.78, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for disodium;ethene;terephthalate is sourced from PubChem (CID 175257755), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).