About silver 4-ethenylbenzoate
silver 4-ethenylbenzoate (PubChem CID 86649830) has the molecular formula C9H7AgO2
and a molecular weight of 255.02 g/mol. Its IUPAC name is silver 4-ethenylbenzoate.
Molecular Properties
| Compound Name | silver 4-ethenylbenzoate |
| PubChem CID | 86649830 |
| Molecular Formula | C9H7AgO2 |
| Molecular Weight | 255.02 g/mol |
| Exact Mass | 253.95 |
| IUPAC Name | silver 4-ethenylbenzoate |
| SMILES | C=Cc1ccc(C(=O)[O-])cc1.[Ag+] |
| InChI | InChI=1S/C9H8O2.Ag/c1-2-7-3-5-8(6-4-7)9(10)11;/h2-6H,1H2,(H,10,11);/q;+1/p-1 |
| InChIKey | LXVRSWWZOWXPDV-UHFFFAOYSA-M |
| XLogP | 0.69 |
| TPSA | 40.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 255.02 |
| LogP ≤ 5 | 0.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze silver 4-ethenylbenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of silver 4-ethenylbenzoate?
The IUPAC name of silver 4-ethenylbenzoate (CID 86649830) is silver 4-ethenylbenzoate.
What is the SMILES notation for silver 4-ethenylbenzoate?
The canonical SMILES for silver 4-ethenylbenzoate is C=Cc1ccc(C(=O)[O-])cc1.[Ag+].
What is the InChIKey of silver 4-ethenylbenzoate?
The InChIKey is LXVRSWWZOWXPDV-UHFFFAOYSA-M. The full InChI is InChI=1S/C9H8O2.Ag/c1-2-7-3-5-8(6-4-7)9(10)11;/h2-6H,1H2,(H,10,11);/q;+1/p-1.
What are the key properties of silver 4-ethenylbenzoate?
silver 4-ethenylbenzoate has a molecular weight of 255.02 g/mol, XLogP of 0.69, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for silver 4-ethenylbenzoate is sourced from PubChem (CID 86649830), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).