C11H14N2O — CID 18766675
1,4-bis(ethenyl)benzene;urea (PubChem CID 18766675) has the molecular formula C11H14N2O and a molecular weight of 190.25 g/mol. Its IUPAC name is 1,4-bis(ethenyl)benzene;urea.
| Compound Name | 1,4-bis(ethenyl)benzene;urea |
|---|---|
| PubChem CID | 18766675 |
| Molecular Formula | C11H14N2O |
| Molecular Weight | 190.25 g/mol |
| Exact Mass | 190.11 |
| IUPAC Name | 1,4-bis(ethenyl)benzene;urea |
| SMILES | C=Cc1ccc(C=C)cc1.NC(N)=O |
| InChI | InChI=1S/C10H10.CH4N2O/c1-3-9-5-7-10(4-2)8-6-9;2-1(3)4/h3-8H,1-2H2;(H4,2,3,4) |
| InChIKey | PSPNUOMTBJAIDW-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 69.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 190.25 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |