About ethane;4-ethenylbenzaldehyde;methanol
ethane;4-ethenylbenzaldehyde;methanol (PubChem CID 145257889) has the molecular formula C14H24O2
and a molecular weight of 224.34 g/mol. Its IUPAC name is ethane;4-ethenylbenzaldehyde;methanol.
Molecular Properties
| Compound Name | ethane;4-ethenylbenzaldehyde;methanol |
| PubChem CID | 145257889 |
| Molecular Formula | C14H24O2 |
| Molecular Weight | 224.34 g/mol |
| Exact Mass | 224.18 |
| IUPAC Name | ethane;4-ethenylbenzaldehyde;methanol |
| SMILES | C=Cc1ccc(C=O)cc1.CC.CC.CO |
| InChI | InChI=1S/C9H8O.2C2H6.CH4O/c1-2-8-3-5-9(7-10)6-4-8;3*1-2/h2-7H,1H2;2*1-2H3;2H,1H3 |
| InChIKey | GDTDJBKNDJLZIO-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 224.34 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze ethane;4-ethenylbenzaldehyde;methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;4-ethenylbenzaldehyde;methanol?
The IUPAC name of ethane;4-ethenylbenzaldehyde;methanol (CID 145257889) is ethane;4-ethenylbenzaldehyde;methanol.
What is the SMILES notation for ethane;4-ethenylbenzaldehyde;methanol?
The canonical SMILES for ethane;4-ethenylbenzaldehyde;methanol is C=Cc1ccc(C=O)cc1.CC.CC.CO.
What is the InChIKey of ethane;4-ethenylbenzaldehyde;methanol?
The InChIKey is GDTDJBKNDJLZIO-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H8O.2C2H6.CH4O/c1-2-8-3-5-9(7-10)6-4-8;3*1-2/h2-7H,1H2;2*1-2H3;2H,1H3.
What are the key properties of ethane;4-ethenylbenzaldehyde;methanol?
ethane;4-ethenylbenzaldehyde;methanol has a molecular weight of 224.34 g/mol, XLogP of 3.80, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;4-ethenylbenzaldehyde;methanol is sourced from PubChem (CID 145257889), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).