C15H18O — CID 142005838
ethane;4-[(3E)-hexa-1,3,5-trien-3-yl]benzaldehyde (PubChem CID 142005838) has the molecular formula C15H18O and a molecular weight of 214.31 g/mol. Its IUPAC name is ethane;4-[(3E)-hexa-1,3,5-trien-3-yl]benzaldehyde.
| Compound Name | ethane;4-[(3E)-hexa-1,3,5-trien-3-yl]benzaldehyde |
|---|---|
| PubChem CID | 142005838 |
| Molecular Formula | C15H18O |
| Molecular Weight | 214.31 g/mol |
| Exact Mass | 214.14 |
| IUPAC Name | ethane;4-[(3E)-hexa-1,3,5-trien-3-yl]benzaldehyde |
| SMILES | C=C/C=C(\C=C)c1ccc(C=O)cc1.CC |
| InChI | InChI=1S/C13H12O.C2H6/c1-3-5-12(4-2)13-8-6-11(10-14)7-9-13;1-2/h3-10H,1-2H2;1-2H3/b12-5+; |
| InChIKey | RNXLYGDTKQUDPW-NKPNRJPBSA-N |
| XLogP | 4.28 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.31 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|