C22H19NO — CID 144675067
4-[2-[4-[C-methyl-N-[(2E)-penta-2,4-dien-2-yl]carbonimidoyl]phenyl]ethynyl]benzaldehyde (PubChem CID 144675067) has the molecular formula C22H19NO and a molecular weight of 313.40 g/mol. Its IUPAC name is 4-[2-[4-[C-methyl-N-[(2E)-penta-2,4-dien-2-yl]carbonimidoyl]phenyl]ethynyl]benzaldehyde.
| Compound Name | 4-[2-[4-[C-methyl-N-[(2E)-penta-2,4-dien-2-yl]carbonimidoyl]phenyl]ethynyl]benzaldehyde |
|---|---|
| PubChem CID | 144675067 |
| Molecular Formula | C22H19NO |
| Molecular Weight | 313.40 g/mol |
| Exact Mass | 313.15 |
| IUPAC Name | 4-[2-[4-[C-methyl-N-[(2E)-penta-2,4-dien-2-yl]carbonimidoyl]phenyl]ethynyl]benzaldehyde |
| SMILES | C=C/C=C(C)/N=C(\C)c1ccc(C#Cc2ccc(C=O)cc2)cc1 |
| InChI | InChI=1S/C22H19NO/c1-4-5-17(2)23-18(3)22-14-12-20(13-15-22)7-6-19-8-10-21(16-24)11-9-19/h4-5,8-16H,1H2,2-3H3/b17-5+,23-18+ |
| InChIKey | DZJMIOOHQJRDBC-VKEWPZNKSA-N |
| XLogP | 4.80 |
| TPSA | 29.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.40 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|