C30H36 — CID 143258113
butane;1-[(3E)-hexa-1,3,5-trien-3-yl]-4-methylbenzene;1-methyl-4-phenylbenzene (PubChem CID 143258113) has the molecular formula C30H36 and a molecular weight of 396.62 g/mol. Its IUPAC name is butane;1-[(3E)-hexa-1,3,5-trien-3-yl]-4-methylbenzene;1-methyl-4-phenylbenzene.
| Compound Name | butane;1-[(3E)-hexa-1,3,5-trien-3-yl]-4-methylbenzene;1-methyl-4-phenylbenzene |
|---|---|
| PubChem CID | 143258113 |
| Molecular Formula | C30H36 |
| Molecular Weight | 396.62 g/mol |
| Exact Mass | 396.28 |
| IUPAC Name | butane;1-[(3E)-hexa-1,3,5-trien-3-yl]-4-methylbenzene;1-methyl-4-phenylbenzene |
| SMILES | C=C/C=C(\C=C)c1ccc(C)cc1.CCCC.Cc1ccc(-c2ccccc2)cc1 |
| InChI | InChI=1S/C13H12.C13H14.C4H10/c1-11-7-9-13(10-8-11)12-5-3-2-4-6-12;1-4-6-12(5-2)13-9-7-11(3)8-10-13;1-3-4-2/h2-10H,1H3;4-10H,1-2H2,3H3;3-4H2,1-2H3/b;12-6+; |
| InChIKey | FVBTXCMJXMSOQM-JFOHBEEMSA-N |
| XLogP | 9.22 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.62 |
| LogP ≤ 5 | 9.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|