C18H17BO2 — CID 174096421
[4-[4-[(3E)-hexa-1,3,5-trien-3-yl]phenyl]phenyl]boronic acid (PubChem CID 174096421) has the molecular formula C18H17BO2 and a molecular weight of 276.14 g/mol. Its IUPAC name is [4-[4-[(3E)-hexa-1,3,5-trien-3-yl]phenyl]phenyl]boronic acid.
| Compound Name | [4-[4-[(3E)-hexa-1,3,5-trien-3-yl]phenyl]phenyl]boronic acid |
|---|---|
| PubChem CID | 174096421 |
| Molecular Formula | C18H17BO2 |
| Molecular Weight | 276.14 g/mol |
| Exact Mass | 276.13 |
| IUPAC Name | [4-[4-[(3E)-hexa-1,3,5-trien-3-yl]phenyl]phenyl]boronic acid |
| SMILES | C=C/C=C(\C=C)c1ccc(-c2ccc(B(O)O)cc2)cc1 |
| InChI | InChI=1S/C18H17BO2/c1-3-5-14(4-2)15-6-8-16(9-7-15)17-10-12-18(13-11-17)19(20)21/h3-13,20-21H,1-2H2/b14-5+ |
| InChIKey | JJZHUDCZAHCCOM-LHHJGKSTSA-N |
| XLogP | 2.79 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.14 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|