C30H26BNO2 — CID 170567798
[4-[4-[(3E)-hexa-1,3,5-trien-3-yl]-N-(2-phenylphenyl)anilino]phenyl]boronic acid (PubChem CID 170567798) has the molecular formula C30H26BNO2 and a molecular weight of 443.36 g/mol. Its IUPAC name is [4-[4-[(3E)-hexa-1,3,5-trien-3-yl]-N-(2-phenylphenyl)anilino]phenyl]boronic acid.
| Compound Name | [4-[4-[(3E)-hexa-1,3,5-trien-3-yl]-N-(2-phenylphenyl)anilino]phenyl]boronic acid |
|---|---|
| PubChem CID | 170567798 |
| Molecular Formula | C30H26BNO2 |
| Molecular Weight | 443.36 g/mol |
| Exact Mass | 443.21 |
| IUPAC Name | [4-[4-[(3E)-hexa-1,3,5-trien-3-yl]-N-(2-phenylphenyl)anilino]phenyl]boronic acid |
| SMILES | C=C/C=C(\C=C)c1ccc(N(c2ccc(B(O)O)cc2)c2ccccc2-c2ccccc2)cc1 |
| InChI | InChI=1S/C30H26BNO2/c1-3-10-23(4-2)24-15-19-27(20-16-24)32(28-21-17-26(18-22-28)31(33)34)30-14-9-8-13-29(30)25-11-6-5-7-12-25/h3-22,33-34H,1-2H2/b23-10+ |
| InChIKey | FWUIINORDQFPJC-AUEPDCJTSA-N |
| XLogP | 6.26 |
| TPSA | 43.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.36 |
| LogP ≤ 5 | 6.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|