C54H45N — CID 142541092
N-[4-[(3E)-hexa-1,3,5-trien-3-yl]phenyl]-10,10,12,12-tetramethyl-4-phenyl-N-(4-phenylphenyl)indeno[2,1-b]fluoren-8-amine (PubChem CID 142541092) has the molecular formula C54H45N and a molecular weight of 707.96 g/mol. Its IUPAC name is N-[4-[(3E)-hexa-1,3,5-trien-3-yl]phenyl]-10,10,12,12-tetramethyl-4-phenyl-N-(4-phenylphenyl)indeno[2,1-b]fluoren-8-amine.
| Compound Name | N-[4-[(3E)-hexa-1,3,5-trien-3-yl]phenyl]-10,10,12,12-tetramethyl-4-phenyl-N-(4-phenylphenyl)indeno[2,1-b]fluoren-8-amine |
|---|---|
| PubChem CID | 142541092 |
| Molecular Formula | C54H45N |
| Molecular Weight | 707.96 g/mol |
| Exact Mass | 707.36 |
| IUPAC Name | N-[4-[(3E)-hexa-1,3,5-trien-3-yl]phenyl]-10,10,12,12-tetramethyl-4-phenyl-N-(4-phenylphenyl)indeno[2,1-b]fluoren-8-amine |
| SMILES | C=C/C=C(\C=C)c1ccc(N(c2ccc(-c3ccccc3)cc2)c2ccc3c(c2)C(C)(C)c2cc4c(cc2-3)-c2c(-c3ccccc3)cccc2C4(C)C)cc1 |
| InChI | InChI=1S/C54H45N/c1-7-16-36(8-2)38-23-27-41(28-24-38)55(42-29-25-39(26-30-42)37-17-11-9-12-18-37)43-31-32-45-46-34-47-51(35-50(46)54(5,6)49(45)33-43)53(3,4)48-22-15-21-44(52(47)48)40-19-13-10-14-20-40/h7-35H,1-2H2,3-6H3/b36-16+ |
| InChIKey | AWOSOMWCIQCOIA-ODQASSKESA-N |
| XLogP | 14.86 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 55 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 707.96 |
| LogP ≤ 5 | 14.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|