C90H68N4 — CID 144761756
4-N-[4-[(3E)-hexa-1,3,5-trien-3-yl]phenyl]-2,5-bis[4-(N-phenylanilino)phenyl]-1-N,1-N,4-N-tris(4-phenylphenyl)benzene-1,4-diamine (PubChem CID 144761756) has the molecular formula C90H68N4 and a molecular weight of 1205.56 g/mol. Its IUPAC name is 4-N-[4-[(3E)-hexa-1,3,5-trien-3-yl]phenyl]-2,5-bis[4-(N-phenylanilino)phenyl]-1-N,1-N,4-N-tris(4-phenylphenyl)benzene-1,4-diamine.
| Compound Name | 4-N-[4-[(3E)-hexa-1,3,5-trien-3-yl]phenyl]-2,5-bis[4-(N-phenylanilino)phenyl]-1-N,1-N,4-N-tris(4-phenylphenyl)benzene-1,4-diamine |
|---|---|
| PubChem CID | 144761756 |
| Molecular Formula | C90H68N4 |
| Molecular Weight | 1205.56 g/mol |
| Exact Mass | 1204.54 |
| IUPAC Name | 4-N-[4-[(3E)-hexa-1,3,5-trien-3-yl]phenyl]-2,5-bis[4-(N-phenylanilino)phenyl]-1-N,1-N,4-N-tris(4-phenylphenyl)benzene-1,4-diamine |
| SMILES | C=C/C=C(\C=C)c1ccc(N(c2ccc(-c3ccccc3)cc2)c2cc(-c3ccc(N(c4ccccc4)c4ccccc4)cc3)c(N(c3ccc(-c4ccccc4)cc3)c3ccc(-c4ccccc4)cc3)cc2-c2ccc(N(c3ccccc3)c3ccccc3)cc2)cc1 |
| InChI | InChI=1S/C90H68N4/c1-3-26-67(4-2)71-41-53-83(54-42-71)93(84-55-43-72(44-56-84)68-27-12-5-13-28-68)89-65-88(76-51-63-82(64-52-76)92(79-37-22-10-23-38-79)80-39-24-11-25-40-80)90(66-87(89)75-49-61-81(62-50-75)91(77-33-18-8-19-34-77)78-35-20-9-21-36-78)94(85-57-45-73(46-58-85)69-29-14-6-15-30-69)86-59-47-74(48-60-86)70-31-16-7-17-32-70/h3-66H,1-2H2/b67-26+ |
| InChIKey | RGXHBKNGCHLHPM-TWNCDITHSA-N |
| XLogP | 25.66 |
| TPSA | 12.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 94 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1205.56 |
| LogP ≤ 5 | 25.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|