C48H38N2 — CID 160604263
2,3,5,6-tetradeuterio-N-phenyl-N-(4-phenylphenyl)-4-[2,3,5,6-tetradeuterio-4-(N-[4-[(3E)-hexa-1,3,5-trien-3-yl]phenyl]anilino)phenyl]aniline (PubChem CID 160604263) has the molecular formula C48H38N2 and a molecular weight of 650.89 g/mol. Its IUPAC name is 2,3,5,6-tetradeuterio-N-phenyl-N-(4-phenylphenyl)-4-[2,3,5,6-tetradeuterio-4-(N-[4-[(3E)-hexa-1,3,5-trien-3-yl]phenyl]anilino)phenyl]aniline.
| Compound Name | 2,3,5,6-tetradeuterio-N-phenyl-N-(4-phenylphenyl)-4-[2,3,5,6-tetradeuterio-4-(N-[4-[(3E)-hexa-1,3,5-trien-3-yl]phenyl]anilino)phenyl]aniline |
|---|---|
| PubChem CID | 160604263 |
| Molecular Formula | C48H38N2 |
| Molecular Weight | 650.89 g/mol |
| Exact Mass | 650.35 |
| IUPAC Name | 2,3,5,6-tetradeuterio-N-phenyl-N-(4-phenylphenyl)-4-[2,3,5,6-tetradeuterio-4-(N-[4-[(3E)-hexa-1,3,5-trien-3-yl]phenyl]anilino)phenyl]aniline |
| SMILES | [2H]c1c([2H])c(N(c2ccccc2)c2ccc(/C(C=C)=C/C=C)cc2)c([2H])c([2H])c1-c1c([2H])c([2H])c(N(c2ccccc2)c2ccc(-c3ccccc3)cc2)c([2H])c1[2H] |
| InChI | InChI=1S/C48H38N2/c1-3-14-37(4-2)39-21-29-45(30-22-39)49(43-17-10-6-11-18-43)47-33-25-41(26-34-47)42-27-35-48(36-28-42)50(44-19-12-7-13-20-44)46-31-23-40(24-32-46)38-15-8-5-9-16-38/h3-36H,1-2H2/b37-14+/i25D,26D,27D,28D,33D,34D,35D,36D |
| InChIKey | LMLGSLFIXHAECD-WSPLRIKXSA-N |
| XLogP | 13.72 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 650.89 |
| LogP ≤ 5 | 13.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|