C43H34N2 — CID 163706220
2,3,5,6-tetradeuterio-N,N-diphenyl-4-[2,3,5,6-tetradeuterio-4-[4-(N-(4-methylphenyl)anilino)phenyl]phenyl]aniline (PubChem CID 163706220) has the molecular formula C43H34N2 and a molecular weight of 586.81 g/mol. Its IUPAC name is 2,3,5,6-tetradeuterio-N,N-diphenyl-4-[2,3,5,6-tetradeuterio-4-[4-(N-(4-methylphenyl)anilino)phenyl]phenyl]aniline.
| Compound Name | 2,3,5,6-tetradeuterio-N,N-diphenyl-4-[2,3,5,6-tetradeuterio-4-[4-(N-(4-methylphenyl)anilino)phenyl]phenyl]aniline |
|---|---|
| PubChem CID | 163706220 |
| Molecular Formula | C43H34N2 |
| Molecular Weight | 586.81 g/mol |
| Exact Mass | 586.32 |
| IUPAC Name | 2,3,5,6-tetradeuterio-N,N-diphenyl-4-[2,3,5,6-tetradeuterio-4-[4-(N-(4-methylphenyl)anilino)phenyl]phenyl]aniline |
| SMILES | [2H]c1c([2H])c(-c2c([2H])c([2H])c(N(c3ccccc3)c3ccccc3)c([2H])c2[2H])c([2H])c([2H])c1-c1ccc(N(c2ccccc2)c2ccc(C)cc2)cc1 |
| InChI | InChI=1S/C43H34N2/c1-33-17-27-41(28-18-33)45(40-15-9-4-10-16-40)43-31-25-37(26-32-43)35-21-19-34(20-22-35)36-23-29-42(30-24-36)44(38-11-5-2-6-12-38)39-13-7-3-8-14-39/h2-32H,1H3/i19D,20D,21D,22D,23D,24D,29D,30D |
| InChIKey | CYLJHXFIJJXMLN-WPHPVWHDSA-N |
| XLogP | 12.27 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 586.81 |
| LogP ≤ 5 | 12.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |