C47H38N2 — CID 143685031
N-[4-[(3E)-hexa-1,3,5-trien-3-yl]phenyl]-N-[4-[4-(N-methyl-3-phenylanilino)phenyl]phenyl]naphthalen-2-amine (PubChem CID 143685031) has the molecular formula C47H38N2 and a molecular weight of 630.84 g/mol. Its IUPAC name is N-[4-[(3E)-hexa-1,3,5-trien-3-yl]phenyl]-N-[4-[4-(N-methyl-3-phenylanilino)phenyl]phenyl]naphthalen-2-amine.
| Compound Name | N-[4-[(3E)-hexa-1,3,5-trien-3-yl]phenyl]-N-[4-[4-(N-methyl-3-phenylanilino)phenyl]phenyl]naphthalen-2-amine |
|---|---|
| PubChem CID | 143685031 |
| Molecular Formula | C47H38N2 |
| Molecular Weight | 630.84 g/mol |
| Exact Mass | 630.30 |
| IUPAC Name | N-[4-[(3E)-hexa-1,3,5-trien-3-yl]phenyl]-N-[4-[4-(N-methyl-3-phenylanilino)phenyl]phenyl]naphthalen-2-amine |
| SMILES | C=C/C=C(\C=C)c1ccc(N(c2ccc(-c3ccc(N(C)c4cccc(-c5ccccc5)c4)cc3)cc2)c2ccc3ccccc3c2)cc1 |
| InChI | InChI=1S/C47H38N2/c1-4-12-35(5-2)38-21-28-44(29-22-38)49(47-32-25-37-15-9-10-16-41(37)34-47)45-30-23-40(24-31-45)39-19-26-43(27-20-39)48(3)46-18-11-17-42(33-46)36-13-7-6-8-14-36/h4-34H,1-2H2,3H3/b35-12+ |
| InChIKey | VFNUIIQJDNTNGD-RHQFVSDJSA-N |
| XLogP | 13.17 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 630.84 |
| LogP ≤ 5 | 13.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|