C39H31N — CID 142474096
N-(4-naphthalen-2-ylphenyl)-3-[(2E)-penta-2,4-dien-2-yl]-N-(4-phenylphenyl)aniline (PubChem CID 142474096) has the molecular formula C39H31N and a molecular weight of 513.68 g/mol. Its IUPAC name is N-(4-naphthalen-2-ylphenyl)-3-[(2E)-penta-2,4-dien-2-yl]-N-(4-phenylphenyl)aniline.
| Compound Name | N-(4-naphthalen-2-ylphenyl)-3-[(2E)-penta-2,4-dien-2-yl]-N-(4-phenylphenyl)aniline |
|---|---|
| PubChem CID | 142474096 |
| Molecular Formula | C39H31N |
| Molecular Weight | 513.68 g/mol |
| Exact Mass | 513.25 |
| IUPAC Name | N-(4-naphthalen-2-ylphenyl)-3-[(2E)-penta-2,4-dien-2-yl]-N-(4-phenylphenyl)aniline |
| SMILES | C=C/C=C(\C)c1cccc(N(c2ccc(-c3ccccc3)cc2)c2ccc(-c3ccc4ccccc4c3)cc2)c1 |
| InChI | InChI=1S/C39H31N/c1-3-10-29(2)34-15-9-16-39(28-34)40(37-23-19-32(20-24-37)30-11-5-4-6-12-30)38-25-21-33(22-26-38)36-18-17-31-13-7-8-14-35(31)27-36/h3-28H,1H2,2H3/b29-10+ |
| InChIKey | DHWCZPUCGANUBY-VYVUJPJFSA-N |
| XLogP | 11.23 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.68 |
| LogP ≤ 5 | 11.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|