C44H33NO — CID 144913860
1-[4-(N-[4-[(3E)-hexa-1,3,5-trien-3-yl]phenyl]-4-phenylanilino)phenyl]phenanthren-4-ol (PubChem CID 144913860) has the molecular formula C44H33NO and a molecular weight of 591.75 g/mol. Its IUPAC name is 1-[4-(N-[4-[(3E)-hexa-1,3,5-trien-3-yl]phenyl]-4-phenylanilino)phenyl]phenanthren-4-ol.
| Compound Name | 1-[4-(N-[4-[(3E)-hexa-1,3,5-trien-3-yl]phenyl]-4-phenylanilino)phenyl]phenanthren-4-ol |
|---|---|
| PubChem CID | 144913860 |
| Molecular Formula | C44H33NO |
| Molecular Weight | 591.75 g/mol |
| Exact Mass | 591.26 |
| IUPAC Name | 1-[4-(N-[4-[(3E)-hexa-1,3,5-trien-3-yl]phenyl]-4-phenylanilino)phenyl]phenanthren-4-ol |
| SMILES | C=C/C=C(\C=C)c1ccc(N(c2ccc(-c3ccccc3)cc2)c2ccc(-c3ccc(O)c4c3ccc3ccccc34)cc2)cc1 |
| InChI | InChI=1S/C44H33NO/c1-3-10-31(4-2)33-15-22-37(23-16-33)45(38-24-17-34(18-25-38)32-11-6-5-7-12-32)39-26-19-36(20-27-39)40-29-30-43(46)44-41-14-9-8-13-35(41)21-28-42(40)44/h3-30,46H,1-2H2/b31-10+ |
| InChIKey | QCBJTLOEHOFFNH-VNTWQREPSA-N |
| XLogP | 12.26 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 591.75 |
| LogP ≤ 5 | 12.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|