C36H29N — CID 88567954
N-[4-[4-[(3E)-hexa-1,3,5-trien-3-yl]phenyl]phenyl]-4-(4-phenylphenyl)aniline (PubChem CID 88567954) has the molecular formula C36H29N and a molecular weight of 475.64 g/mol. Its IUPAC name is N-[4-[4-[(3E)-hexa-1,3,5-trien-3-yl]phenyl]phenyl]-4-(4-phenylphenyl)aniline.
| Compound Name | N-[4-[4-[(3E)-hexa-1,3,5-trien-3-yl]phenyl]phenyl]-4-(4-phenylphenyl)aniline |
|---|---|
| PubChem CID | 88567954 |
| Molecular Formula | C36H29N |
| Molecular Weight | 475.64 g/mol |
| Exact Mass | 475.23 |
| IUPAC Name | N-[4-[4-[(3E)-hexa-1,3,5-trien-3-yl]phenyl]phenyl]-4-(4-phenylphenyl)aniline |
| SMILES | C=C/C=C(\C=C)c1ccc(-c2ccc(Nc3ccc(-c4ccc(-c5ccccc5)cc4)cc3)cc2)cc1 |
| InChI | InChI=1S/C36H29N/c1-3-8-27(4-2)29-11-13-31(14-12-29)33-19-23-35(24-20-33)37-36-25-21-34(22-26-36)32-17-15-30(16-18-32)28-9-6-5-7-10-28/h3-26,37H,1-2H2/b27-8+ |
| InChIKey | KIBQCKFFEDCDOD-FLUNURKVSA-N |
| XLogP | 10.19 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.64 |
| LogP ≤ 5 | 10.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|