C14H20 — CID 142347036
ethane;[(3E)-hexa-1,3,5-trien-3-yl]benzene;molecular hydrogen (PubChem CID 142347036) has the molecular formula C14H20 and a molecular weight of 188.31 g/mol. Its IUPAC name is ethane;[(3E)-hexa-1,3,5-trien-3-yl]benzene;molecular hydrogen.
| Compound Name | ethane;[(3E)-hexa-1,3,5-trien-3-yl]benzene;molecular hydrogen |
|---|---|
| PubChem CID | 142347036 |
| Molecular Formula | C14H20 |
| Molecular Weight | 188.31 g/mol |
| Exact Mass | 188.16 |
| IUPAC Name | ethane;[(3E)-hexa-1,3,5-trien-3-yl]benzene;molecular hydrogen |
| SMILES | C=C/C=C(\C=C)c1ccccc1.CC.[H][H] |
| InChI | InChI=1S/C12H12.C2H6.H2/c1-3-8-11(4-2)12-9-6-5-7-10-12;1-2;/h3-10H,1-2H2;1-2H3;1H/b11-8+;; |
| InChIKey | WKYCVDKPARDJEO-OHENRDTHSA-N |
| XLogP | 4.71 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 188.31 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|