ethane;[(3E)-hexa-1,3,5-trien-3-yl]benzene;molecular hydrogen

C14H20 — CID 142347036

IUPACethane;[(3E)-hexa-1,3,5-trien-3-yl]benzene;molecular hydrogen
SMILESC=C/C=C(\C=C)c1ccccc1.CC.[H][H]
InChIInChI=1S/C12H12.C2H6.H2/c1-3-8-11(4-2)12-9-6-5-7-10-12;1-2;/h3-10H,1-2H2;1-2H3;1H/b11-8+;;
InChIKeyWKYCVDKPARDJEO-OHENRDTHSA-N
MW188.31 g/mol
LogP4.71
Rot. Bonds3

About ethane;[(3E)-hexa-1,3,5-trien-3-yl]benzene;molecular hydrogen

ethane;[(3E)-hexa-1,3,5-trien-3-yl]benzene;molecular hydrogen (PubChem CID 142347036) has the molecular formula C14H20 and a molecular weight of 188.31 g/mol. Its IUPAC name is ethane;[(3E)-hexa-1,3,5-trien-3-yl]benzene;molecular hydrogen.

Molecular Properties

Compound Nameethane;[(3E)-hexa-1,3,5-trien-3-yl]benzene;molecular hydrogen
PubChem CID142347036
Molecular FormulaC14H20
Molecular Weight188.31 g/mol
Exact Mass188.16
IUPAC Nameethane;[(3E)-hexa-1,3,5-trien-3-yl]benzene;molecular hydrogen
SMILESC=C/C=C(\C=C)c1ccccc1.CC.[H][H]
InChIInChI=1S/C12H12.C2H6.H2/c1-3-8-11(4-2)12-9-6-5-7-10-12;1-2;/h3-10H,1-2H2;1-2H3;1H/b11-8+;;
InChIKeyWKYCVDKPARDJEO-OHENRDTHSA-N
XLogP4.71
TPSA0.00 Ų
H-Bond Donors
H-Bond Acceptors
Rotatable Bonds3
Heavy Atoms14
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500188.31
LogP ≤ 54.71
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 100

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'polyene', 'substructure': 'N/A'}

Analyze ethane;[(3E)-hexa-1,3,5-trien-3-yl]benzene;molecular hydrogen with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of ethane;[(3E)-hexa-1,3,5-trien-3-yl]benzene;molecular hydrogen?
The IUPAC name of ethane;[(3E)-hexa-1,3,5-trien-3-yl]benzene;molecular hydrogen (CID 142347036) is ethane;[(3E)-hexa-1,3,5-trien-3-yl]benzene;molecular hydrogen.
What is the SMILES notation for ethane;[(3E)-hexa-1,3,5-trien-3-yl]benzene;molecular hydrogen?
The canonical SMILES for ethane;[(3E)-hexa-1,3,5-trien-3-yl]benzene;molecular hydrogen is C=C/C=C(\C=C)c1ccccc1.CC.[H][H].
What is the InChIKey of ethane;[(3E)-hexa-1,3,5-trien-3-yl]benzene;molecular hydrogen?
The InChIKey is WKYCVDKPARDJEO-OHENRDTHSA-N. The full InChI is InChI=1S/C12H12.C2H6.H2/c1-3-8-11(4-2)12-9-6-5-7-10-12;1-2;/h3-10H,1-2H2;1-2H3;1H/b11-8+;;.
What are the key properties of ethane;[(3E)-hexa-1,3,5-trien-3-yl]benzene;molecular hydrogen?
ethane;[(3E)-hexa-1,3,5-trien-3-yl]benzene;molecular hydrogen has a molecular weight of 188.31 g/mol, XLogP of 4.71, 3 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;[(3E)-hexa-1,3,5-trien-3-yl]benzene;molecular hydrogen is sourced from PubChem (CID 142347036), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).