C17H26O — CID 145162668
ethane;methanol;[(3E,5Z)-octa-1,3,5-trien-3-yl]benzene (PubChem CID 145162668) has the molecular formula C17H26O and a molecular weight of 246.39 g/mol. Its IUPAC name is ethane;methanol;[(3E,5Z)-octa-1,3,5-trien-3-yl]benzene.
| Compound Name | ethane;methanol;[(3E,5Z)-octa-1,3,5-trien-3-yl]benzene |
|---|---|
| PubChem CID | 145162668 |
| Molecular Formula | C17H26O |
| Molecular Weight | 246.39 g/mol |
| Exact Mass | 246.20 |
| IUPAC Name | ethane;methanol;[(3E,5Z)-octa-1,3,5-trien-3-yl]benzene |
| SMILES | C=C/C(=C\C=C/CC)c1ccccc1.CC.CO |
| InChI | InChI=1S/C14H16.C2H6.CH4O/c1-3-5-7-10-13(4-2)14-11-8-6-9-12-14;2*1-2/h4-12H,2-3H2,1H3;1-2H3;2H,1H3/b7-5-,13-10+;; |
| InChIKey | NTAUUVWPRXIQGZ-XZRZEVNUSA-N |
| XLogP | 4.86 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.39 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|