C22H24N2 — CID 143422524
[(3E,5Z)-hepta-1,3,5-trien-3-yl]benzene;2-methyl-4-phenyl-1H-diazete (PubChem CID 143422524) has the molecular formula C22H24N2 and a molecular weight of 316.45 g/mol. Its IUPAC name is [(3E,5Z)-hepta-1,3,5-trien-3-yl]benzene;2-methyl-4-phenyl-1H-diazete.
| Compound Name | [(3E,5Z)-hepta-1,3,5-trien-3-yl]benzene;2-methyl-4-phenyl-1H-diazete |
|---|---|
| PubChem CID | 143422524 |
| Molecular Formula | C22H24N2 |
| Molecular Weight | 316.45 g/mol |
| Exact Mass | 316.19 |
| IUPAC Name | [(3E,5Z)-hepta-1,3,5-trien-3-yl]benzene;2-methyl-4-phenyl-1H-diazete |
| SMILES | C=C/C(=C\C=C/C)c1ccccc1.Cn1cc(-c2ccccc2)[nH]1 |
| InChI | InChI=1S/C13H14.C9H10N2/c1-3-5-9-12(4-2)13-10-7-6-8-11-13;1-11-7-9(10-11)8-5-3-2-4-6-8/h3-11H,2H2,1H3;2-7,10H,1H3/b5-3-,12-9+; |
| InChIKey | RQYTWTZXMWVOIQ-QWYOJGFYSA-N |
| XLogP | 5.85 |
| TPSA | 20.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.45 |
| LogP ≤ 5 | 5.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|