C44H36 — CID 144761623
5,12-bis[(3E,5Z)-hepta-1,3,5-trien-3-yl]-6,11-diphenyltetracene (PubChem CID 144761623) has the molecular formula C44H36 and a molecular weight of 564.77 g/mol. Its IUPAC name is 5,12-bis[(3E,5Z)-hepta-1,3,5-trien-3-yl]-6,11-diphenyltetracene.
| Compound Name | 5,12-bis[(3E,5Z)-hepta-1,3,5-trien-3-yl]-6,11-diphenyltetracene |
|---|---|
| PubChem CID | 144761623 |
| Molecular Formula | C44H36 |
| Molecular Weight | 564.77 g/mol |
| Exact Mass | 564.28 |
| IUPAC Name | 5,12-bis[(3E,5Z)-hepta-1,3,5-trien-3-yl]-6,11-diphenyltetracene |
| SMILES | C=C/C(=C\C=C/C)c1c2ccccc2c(/C(C=C)=C/C=C\C)c2c(-c3ccccc3)c3ccccc3c(-c3ccccc3)c12 |
| InChI | InChI=1S/C44H36/c1-5-9-21-31(7-3)39-35-27-17-18-28-36(35)40(32(8-4)22-10-6-2)44-42(34-25-15-12-16-26-34)38-30-20-19-29-37(38)41(43(39)44)33-23-13-11-14-24-33/h5-30H,3-4H2,1-2H3/b9-5-,10-6-,31-21+,32-22+ |
| InChIKey | WWROXQDKTPTHKU-YODVZDDTSA-N |
| XLogP | 12.77 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 8 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 564.77 |
| LogP ≤ 5 | 12.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|