C32H38 — CID 143808734
ethane;9-[(2E,4Z)-hepta-2,4,6-trien-3-yl]-10-[(3E,5Z)-hepta-1,3,5-trien-3-yl]anthracene (PubChem CID 143808734) has the molecular formula C32H38 and a molecular weight of 422.66 g/mol. Its IUPAC name is ethane;9-[(2E,4Z)-hepta-2,4,6-trien-3-yl]-10-[(3E,5Z)-hepta-1,3,5-trien-3-yl]anthracene.
| Compound Name | ethane;9-[(2E,4Z)-hepta-2,4,6-trien-3-yl]-10-[(3E,5Z)-hepta-1,3,5-trien-3-yl]anthracene |
|---|---|
| PubChem CID | 143808734 |
| Molecular Formula | C32H38 |
| Molecular Weight | 422.66 g/mol |
| Exact Mass | 422.30 |
| IUPAC Name | ethane;9-[(2E,4Z)-hepta-2,4,6-trien-3-yl]-10-[(3E,5Z)-hepta-1,3,5-trien-3-yl]anthracene |
| SMILES | C=C/C=C\C(=C/C)c1c2ccccc2c(/C(C=C)=C/C=C\C)c2ccccc12.CC.CC |
| InChI | InChI=1S/C28H26.2C2H6/c1-5-9-15-21(7-3)27-23-17-11-13-19-25(23)28(22(8-4)16-10-6-2)26-20-14-12-18-24(26)27;2*1-2/h5-20H,1,4H2,2-3H3;2*1-2H3/b10-6-,15-9-,21-7+,22-16+;; |
| InChIKey | APVLKVSWZNDHIE-VRFCVNPVSA-N |
| XLogP | 10.34 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.66 |
| LogP ≤ 5 | 10.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|