C13H14 — CID 12628363
[(2E,4Z)-hepta-2,4,6-trien-3-yl]benzene (PubChem CID 12628363) has the molecular formula C13H14 and a molecular weight of 170.25 g/mol. Its IUPAC name is [(2E,4Z)-hepta-2,4,6-trien-3-yl]benzene.
| Compound Name | [(2E,4Z)-hepta-2,4,6-trien-3-yl]benzene |
|---|---|
| PubChem CID | 12628363 |
| Molecular Formula | C13H14 |
| Molecular Weight | 170.25 g/mol |
| Exact Mass | 170.11 |
| IUPAC Name | [(2E,4Z)-hepta-2,4,6-trien-3-yl]benzene |
| SMILES | C=C/C=C\C(=C/C)c1ccccc1 |
| InChI | InChI=1S/C13H14/c1-3-5-9-12(4-2)13-10-7-6-8-11-13/h3-11H,1H2,2H3/b9-5-,12-4+ |
| InChIKey | QKNBIZHZXAVVAS-WQPWRAGBSA-N |
| XLogP | 3.83 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 170.25 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|