C17H26S — CID 143899348
ethane;(3Z,5E)-5-phenylhepta-1,3,5-triene-2-thiol (PubChem CID 143899348) has the molecular formula C17H26S and a molecular weight of 262.46 g/mol. Its IUPAC name is ethane;(3Z,5E)-5-phenylhepta-1,3,5-triene-2-thiol.
| Compound Name | ethane;(3Z,5E)-5-phenylhepta-1,3,5-triene-2-thiol |
|---|---|
| PubChem CID | 143899348 |
| Molecular Formula | C17H26S |
| Molecular Weight | 262.46 g/mol |
| Exact Mass | 262.18 |
| IUPAC Name | ethane;(3Z,5E)-5-phenylhepta-1,3,5-triene-2-thiol |
| SMILES | C=C(S)/C=C\C(=C/C)c1ccccc1.CC.CC |
| InChI | InChI=1S/C13H14S.2C2H6/c1-3-12(10-9-11(2)14)13-7-5-4-6-8-13;2*1-2/h3-10,14H,2H2,1H3;2*1-2H3/b10-9-,12-3+;; |
| InChIKey | IEVZJZGUBHIKBF-DAMSXLNMSA-N |
| XLogP | 6.14 |
| TPSA | 0.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.46 |
| LogP ≤ 5 | 6.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|