About 2-phenylbut-2-enal;hydrate
2-phenylbut-2-enal;hydrate (PubChem CID 172778769) has the molecular formula C10H12O2
and a molecular weight of 164.20 g/mol. Its IUPAC name is 2-phenylbut-2-enal;hydrate.
Molecular Properties
| Compound Name | 2-phenylbut-2-enal;hydrate |
| PubChem CID | 172778769 |
| Molecular Formula | C10H12O2 |
| Molecular Weight | 164.20 g/mol |
| Exact Mass | 164.08 |
| IUPAC Name | 2-phenylbut-2-enal;hydrate |
| SMILES | CC=C(C=O)c1ccccc1.O |
| InChI | InChI=1S/C10H10O.H2O/c1-2-9(8-11)10-6-4-3-5-7-10;/h2-8H,1H3;1H2 |
| InChIKey | ZRZGCJPUHMDLKY-UHFFFAOYSA-N |
| XLogP | 1.46 |
| TPSA | 48.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 164.20 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze 2-phenylbut-2-enal;hydrate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-phenylbut-2-enal;hydrate?
The IUPAC name of 2-phenylbut-2-enal;hydrate (CID 172778769) is 2-phenylbut-2-enal;hydrate.
What is the SMILES notation for 2-phenylbut-2-enal;hydrate?
The canonical SMILES for 2-phenylbut-2-enal;hydrate is CC=C(C=O)c1ccccc1.O.
What is the InChIKey of 2-phenylbut-2-enal;hydrate?
The InChIKey is ZRZGCJPUHMDLKY-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H10O.H2O/c1-2-9(8-11)10-6-4-3-5-7-10;/h2-8H,1H3;1H2.
What are the key properties of 2-phenylbut-2-enal;hydrate?
2-phenylbut-2-enal;hydrate has a molecular weight of 164.20 g/mol, XLogP of 1.46, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-phenylbut-2-enal;hydrate is sourced from PubChem (CID 172778769), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).