C12H11F3O — CID 125493234
(E,4R)-5,5,5-trifluoro-4-methyl-2-phenylpent-2-enal (PubChem CID 125493234) has the molecular formula C12H11F3O and a molecular weight of 228.21 g/mol. Its IUPAC name is (E,4R)-5,5,5-trifluoro-4-methyl-2-phenylpent-2-enal.
| Compound Name | (E,4R)-5,5,5-trifluoro-4-methyl-2-phenylpent-2-enal |
|---|---|
| PubChem CID | 125493234 |
| Molecular Formula | C12H11F3O |
| Molecular Weight | 228.21 g/mol |
| Exact Mass | 228.08 |
| IUPAC Name | (E,4R)-5,5,5-trifluoro-4-methyl-2-phenylpent-2-enal |
| SMILES | C[C@H](/C=C(/C=O)c1ccccc1)C(F)(F)F |
| InChI | InChI=1S/C12H11F3O/c1-9(12(13,14)15)7-11(8-16)10-5-3-2-4-6-10/h2-9H,1H3/b11-7-/t9-/m1/s1 |
| InChIKey | KZCJJNUWVJTJDT-MDXIRLPMSA-N |
| XLogP | 3.47 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.21 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|