About 2-phenylhex-2-enal
2-phenylhex-2-enal (PubChem CID 3023641) has the molecular formula C12H14O
and a molecular weight of 174.24 g/mol. Its IUPAC name is 2-phenylhex-2-enal.
Molecular Properties
| Compound Name | 2-phenylhex-2-enal |
| PubChem CID | 3023641 |
| Molecular Formula | C12H14O |
| Molecular Weight | 174.24 g/mol |
| Exact Mass | 174.10 |
| IUPAC Name | 2-phenylhex-2-enal |
| SMILES | CCCC=C(C=O)c1ccccc1 |
| InChI | InChI=1S/C12H14O/c1-2-3-7-12(10-13)11-8-5-4-6-9-11/h4-10H,2-3H2,1H3 |
| InChIKey | LYAVRIBWJOVBLZ-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 174.24 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze 2-phenylhex-2-enal with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-phenylhex-2-enal?
The IUPAC name of 2-phenylhex-2-enal (CID 3023641) is 2-phenylhex-2-enal.
What is the SMILES notation for 2-phenylhex-2-enal?
The canonical SMILES for 2-phenylhex-2-enal is CCCC=C(C=O)c1ccccc1.
What is the InChIKey of 2-phenylhex-2-enal?
The InChIKey is LYAVRIBWJOVBLZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H14O/c1-2-3-7-12(10-13)11-8-5-4-6-9-11/h4-10H,2-3H2,1H3.
What are the key properties of 2-phenylhex-2-enal?
2-phenylhex-2-enal has a molecular weight of 174.24 g/mol, XLogP of 3.07, 4 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-phenylhex-2-enal is sourced from PubChem (CID 3023641), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).