C20H28N2O — CID 174886049
2-phenyl-4,4-di(piperidin-1-yl)but-2-enal (PubChem CID 174886049) has the molecular formula C20H28N2O and a molecular weight of 312.46 g/mol. Its IUPAC name is 2-phenyl-4,4-di(piperidin-1-yl)but-2-enal.
| Compound Name | 2-phenyl-4,4-di(piperidin-1-yl)but-2-enal |
|---|---|
| PubChem CID | 174886049 |
| Molecular Formula | C20H28N2O |
| Molecular Weight | 312.46 g/mol |
| Exact Mass | 312.22 |
| IUPAC Name | 2-phenyl-4,4-di(piperidin-1-yl)but-2-enal |
| SMILES | O=CC(=CC(N1CCCCC1)N1CCCCC1)c1ccccc1 |
| InChI | InChI=1S/C20H28N2O/c23-17-19(18-10-4-1-5-11-18)16-20(21-12-6-2-7-13-21)22-14-8-3-9-15-22/h1,4-5,10-11,16-17,20H,2-3,6-9,12-15H2 |
| InChIKey | DDHJVKYMPOZWQL-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.46 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|