C14H19N — CID 10932509
1-(1-phenylprop-2-enyl)piperidine (PubChem CID 10932509) has the molecular formula C14H19N and a molecular weight of 201.31 g/mol. Its IUPAC name is 1-(1-phenylprop-2-enyl)piperidine.
| Compound Name | 1-(1-phenylprop-2-enyl)piperidine |
|---|---|
| PubChem CID | 10932509 |
| Molecular Formula | C14H19N |
| Molecular Weight | 201.31 g/mol |
| Exact Mass | 201.15 |
| IUPAC Name | 1-(1-phenylprop-2-enyl)piperidine |
| SMILES | C=CC(c1ccccc1)N1CCCCC1 |
| InChI | InChI=1S/C14H19N/c1-2-14(13-9-5-3-6-10-13)15-11-7-4-8-12-15/h2-3,5-6,9-10,14H,1,4,7-8,11-12H2 |
| InChIKey | LEWMUNHKWOGMOP-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 201.31 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|