C23H24ClN — CID 154716951
1-[1-(4-chlorophenyl)-4-phenylhex-5-en-1-yn-3-yl]piperidine (PubChem CID 154716951) has the molecular formula C23H24ClN and a molecular weight of 349.91 g/mol. Its IUPAC name is 1-[1-(4-chlorophenyl)-4-phenylhex-5-en-1-yn-3-yl]piperidine.
| Compound Name | 1-[1-(4-chlorophenyl)-4-phenylhex-5-en-1-yn-3-yl]piperidine |
|---|---|
| PubChem CID | 154716951 |
| Molecular Formula | C23H24ClN |
| Molecular Weight | 349.91 g/mol |
| Exact Mass | 349.16 |
| IUPAC Name | 1-[1-(4-chlorophenyl)-4-phenylhex-5-en-1-yn-3-yl]piperidine |
| SMILES | C=CC(c1ccccc1)C(C#Cc1ccc(Cl)cc1)N1CCCCC1 |
| InChI | InChI=1S/C23H24ClN/c1-2-22(20-9-5-3-6-10-20)23(25-17-7-4-8-18-25)16-13-19-11-14-21(24)15-12-19/h2-3,5-6,9-12,14-15,22-23H,1,4,7-8,17-18H2 |
| InChIKey | UDBMXGGAHCXLQI-UHFFFAOYSA-N |
| XLogP | 5.52 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.91 |
| LogP ≤ 5 | 5.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|