C20H21NO — CID 69128866
1-phenyl-3-(4-piperidin-1-ylphenyl)prop-2-yn-1-ol (PubChem CID 69128866) has the molecular formula C20H21NO and a molecular weight of 291.39 g/mol. Its IUPAC name is 1-phenyl-3-(4-piperidin-1-ylphenyl)prop-2-yn-1-ol.
| Compound Name | 1-phenyl-3-(4-piperidin-1-ylphenyl)prop-2-yn-1-ol |
|---|---|
| PubChem CID | 69128866 |
| Molecular Formula | C20H21NO |
| Molecular Weight | 291.39 g/mol |
| Exact Mass | 291.16 |
| IUPAC Name | 1-phenyl-3-(4-piperidin-1-ylphenyl)prop-2-yn-1-ol |
| SMILES | OC(C#Cc1ccc(N2CCCCC2)cc1)c1ccccc1 |
| InChI | InChI=1S/C20H21NO/c22-20(18-7-3-1-4-8-18)14-11-17-9-12-19(13-10-17)21-15-5-2-6-16-21/h1,3-4,7-10,12-13,20,22H,2,5-6,15-16H2 |
| InChIKey | ICMLUWFVPGZBCG-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.39 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|