About ethane;methanol;1-phenylpiperidine
ethane;methanol;1-phenylpiperidine (PubChem CID 177175072) has the molecular formula C14H25NO
and a molecular weight of 223.36 g/mol. Its IUPAC name is ethane;methanol;1-phenylpiperidine.
Molecular Properties
| Compound Name | ethane;methanol;1-phenylpiperidine |
| PubChem CID | 177175072 |
| Molecular Formula | C14H25NO |
| Molecular Weight | 223.36 g/mol |
| Exact Mass | 223.19 |
| IUPAC Name | ethane;methanol;1-phenylpiperidine |
| SMILES | CC.CO.c1ccc(N2CCCCC2)cc1 |
| InChI | InChI=1S/C11H15N.C2H6.CH4O/c1-3-7-11(8-4-1)12-9-5-2-6-10-12;2*1-2/h1,3-4,7-8H,2,5-6,9-10H2;1-2H3;2H,1H3 |
| InChIKey | KODROPOYZVOSIH-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 223.36 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze ethane;methanol;1-phenylpiperidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;methanol;1-phenylpiperidine?
The IUPAC name of ethane;methanol;1-phenylpiperidine (CID 177175072) is ethane;methanol;1-phenylpiperidine.
What is the SMILES notation for ethane;methanol;1-phenylpiperidine?
The canonical SMILES for ethane;methanol;1-phenylpiperidine is CC.CO.c1ccc(N2CCCCC2)cc1.
What is the InChIKey of ethane;methanol;1-phenylpiperidine?
The InChIKey is KODROPOYZVOSIH-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H15N.C2H6.CH4O/c1-3-7-11(8-4-1)12-9-5-2-6-10-12;2*1-2/h1,3-4,7-8H,2,5-6,9-10H2;1-2H3;2H,1H3.
What are the key properties of ethane;methanol;1-phenylpiperidine?
ethane;methanol;1-phenylpiperidine has a molecular weight of 223.36 g/mol, XLogP of 3.31, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;methanol;1-phenylpiperidine is sourced from PubChem (CID 177175072), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).