About methylcyclohexane;1-phenylpiperidine
methylcyclohexane;1-phenylpiperidine (PubChem CID 174582589) has the molecular formula C18H29N
and a molecular weight of 259.44 g/mol. Its IUPAC name is methylcyclohexane;1-phenylpiperidine.
Molecular Properties
| Compound Name | methylcyclohexane;1-phenylpiperidine |
| PubChem CID | 174582589 |
| Molecular Formula | C18H29N |
| Molecular Weight | 259.44 g/mol |
| Exact Mass | 259.23 |
| IUPAC Name | methylcyclohexane;1-phenylpiperidine |
| SMILES | CC1CCCCC1.c1ccc(N2CCCCC2)cc1 |
| InChI | InChI=1S/C11H15N.C7H14/c1-3-7-11(8-4-1)12-9-5-2-6-10-12;1-7-5-3-2-4-6-7/h1,3-4,7-8H,2,5-6,9-10H2;7H,2-6H2,1H3 |
| InChIKey | PLVYDBFJKUAXGS-UHFFFAOYSA-N |
| XLogP | 5.26 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 259.44 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze methylcyclohexane;1-phenylpiperidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methylcyclohexane;1-phenylpiperidine?
The IUPAC name of methylcyclohexane;1-phenylpiperidine (CID 174582589) is methylcyclohexane;1-phenylpiperidine.
What is the SMILES notation for methylcyclohexane;1-phenylpiperidine?
The canonical SMILES for methylcyclohexane;1-phenylpiperidine is CC1CCCCC1.c1ccc(N2CCCCC2)cc1.
What is the InChIKey of methylcyclohexane;1-phenylpiperidine?
The InChIKey is PLVYDBFJKUAXGS-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H15N.C7H14/c1-3-7-11(8-4-1)12-9-5-2-6-10-12;1-7-5-3-2-4-6-7/h1,3-4,7-8H,2,5-6,9-10H2;7H,2-6H2,1H3.
What are the key properties of methylcyclohexane;1-phenylpiperidine?
methylcyclohexane;1-phenylpiperidine has a molecular weight of 259.44 g/mol, XLogP of 5.26, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for methylcyclohexane;1-phenylpiperidine is sourced from PubChem (CID 174582589), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).