About 1-phenylpiperidine;phosphenous acid
1-phenylpiperidine;phosphenous acid (PubChem CID 174871848) has the molecular formula C11H16NO2P
and a molecular weight of 225.23 g/mol. Its IUPAC name is 1-phenylpiperidine;phosphenous acid.
Molecular Properties
| Compound Name | 1-phenylpiperidine;phosphenous acid |
| PubChem CID | 174871848 |
| Molecular Formula | C11H16NO2P |
| Molecular Weight | 225.23 g/mol |
| Exact Mass | 225.09 |
| IUPAC Name | 1-phenylpiperidine;phosphenous acid |
| SMILES | O=PO.c1ccc(N2CCCCC2)cc1 |
| InChI | InChI=1S/C11H15N.HO2P/c1-3-7-11(8-4-1)12-9-5-2-6-10-12;1-3-2/h1,3-4,7-8H,2,5-6,9-10H2;(H,1,2) |
| InChIKey | WGFWJONFTPNATG-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 225.23 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze 1-phenylpiperidine;phosphenous acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-phenylpiperidine;phosphenous acid?
The IUPAC name of 1-phenylpiperidine;phosphenous acid (CID 174871848) is 1-phenylpiperidine;phosphenous acid.
What is the SMILES notation for 1-phenylpiperidine;phosphenous acid?
The canonical SMILES for 1-phenylpiperidine;phosphenous acid is O=PO.c1ccc(N2CCCCC2)cc1.
What is the InChIKey of 1-phenylpiperidine;phosphenous acid?
The InChIKey is WGFWJONFTPNATG-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H15N.HO2P/c1-3-7-11(8-4-1)12-9-5-2-6-10-12;1-3-2/h1,3-4,7-8H,2,5-6,9-10H2;(H,1,2).
What are the key properties of 1-phenylpiperidine;phosphenous acid?
1-phenylpiperidine;phosphenous acid has a molecular weight of 225.23 g/mol, XLogP of 2.86, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-phenylpiperidine;phosphenous acid is sourced from PubChem (CID 174871848), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).