1-phenylpiperidine;phosphenous acid

C11H16NO2P — CID 174871848

IUPAC1-phenylpiperidine;phosphenous acid
SMILESO=PO.c1ccc(N2CCCCC2)cc1
InChIInChI=1S/C11H15N.HO2P/c1-3-7-11(8-4-1)12-9-5-2-6-10-12;1-3-2/h1,3-4,7-8H,2,5-6,9-10H2;(H,1,2)
InChIKeyWGFWJONFTPNATG-UHFFFAOYSA-N
MW225.23 g/mol
LogP2.86
Rot. Bonds1

About 1-phenylpiperidine;phosphenous acid

1-phenylpiperidine;phosphenous acid (PubChem CID 174871848) has the molecular formula C11H16NO2P and a molecular weight of 225.23 g/mol. Its IUPAC name is 1-phenylpiperidine;phosphenous acid.

Molecular Properties

Compound Name1-phenylpiperidine;phosphenous acid
PubChem CID174871848
Molecular FormulaC11H16NO2P
Molecular Weight225.23 g/mol
Exact Mass225.09
IUPAC Name1-phenylpiperidine;phosphenous acid
SMILESO=PO.c1ccc(N2CCCCC2)cc1
InChIInChI=1S/C11H15N.HO2P/c1-3-7-11(8-4-1)12-9-5-2-6-10-12;1-3-2/h1,3-4,7-8H,2,5-6,9-10H2;(H,1,2)
InChIKeyWGFWJONFTPNATG-UHFFFAOYSA-N
XLogP2.86
TPSA40.54 Ų
H-Bond Donors1
H-Bond Acceptors2
Rotatable Bonds1
Heavy Atoms15
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500225.23
LogP ≤ 52.86
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 102

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'phosphor', 'substructure': 'N/A'}

Analyze 1-phenylpiperidine;phosphenous acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 1-phenylpiperidine;phosphenous acid?
The IUPAC name of 1-phenylpiperidine;phosphenous acid (CID 174871848) is 1-phenylpiperidine;phosphenous acid.
What is the SMILES notation for 1-phenylpiperidine;phosphenous acid?
The canonical SMILES for 1-phenylpiperidine;phosphenous acid is O=PO.c1ccc(N2CCCCC2)cc1.
What is the InChIKey of 1-phenylpiperidine;phosphenous acid?
The InChIKey is WGFWJONFTPNATG-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H15N.HO2P/c1-3-7-11(8-4-1)12-9-5-2-6-10-12;1-3-2/h1,3-4,7-8H,2,5-6,9-10H2;(H,1,2).
What are the key properties of 1-phenylpiperidine;phosphenous acid?
1-phenylpiperidine;phosphenous acid has a molecular weight of 225.23 g/mol, XLogP of 2.86, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-phenylpiperidine;phosphenous acid is sourced from PubChem (CID 174871848), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).