C17H23N3O2 — CID 2200683
1-(4-phenylpiperazin-1-yl)-2-piperidin-1-ylethane-1,2-dione (PubChem CID 2200683) has the molecular formula C17H23N3O2 and a molecular weight of 301.39 g/mol. Its IUPAC name is 1-(4-phenylpiperazin-1-yl)-2-piperidin-1-ylethane-1,2-dione.
| Compound Name | 1-(4-phenylpiperazin-1-yl)-2-piperidin-1-ylethane-1,2-dione |
|---|---|
| PubChem CID | 2200683 |
| Molecular Formula | C17H23N3O2 |
| Molecular Weight | 301.39 g/mol |
| Exact Mass | 301.18 |
| IUPAC Name | 1-(4-phenylpiperazin-1-yl)-2-piperidin-1-ylethane-1,2-dione |
| SMILES | O=C(C(=O)N1CCN(c2ccccc2)CC1)N1CCCCC1 |
| InChI | InChI=1S/C17H23N3O2/c21-16(19-9-5-2-6-10-19)17(22)20-13-11-18(12-14-20)15-7-3-1-4-8-15/h1,3-4,7-8H,2,5-6,9-14H2 |
| InChIKey | ZDQISPAYHPRBOJ-UHFFFAOYSA-N |
| XLogP | 1.35 |
| TPSA | 43.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.39 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|