C19H27N3O2 — CID 108523573
1-(2-ethylpiperidin-1-yl)-2-(4-phenylpiperazin-1-yl)ethane-1,2-dione (PubChem CID 108523573) has the molecular formula C19H27N3O2 and a molecular weight of 329.44 g/mol. Its IUPAC name is 1-(2-ethylpiperidin-1-yl)-2-(4-phenylpiperazin-1-yl)ethane-1,2-dione.
| Compound Name | 1-(2-ethylpiperidin-1-yl)-2-(4-phenylpiperazin-1-yl)ethane-1,2-dione |
|---|---|
| PubChem CID | 108523573 |
| Molecular Formula | C19H27N3O2 |
| Molecular Weight | 329.44 g/mol |
| Exact Mass | 329.21 |
| IUPAC Name | 1-(2-ethylpiperidin-1-yl)-2-(4-phenylpiperazin-1-yl)ethane-1,2-dione |
| SMILES | CCC1CCCCN1C(=O)C(=O)N1CCN(c2ccccc2)CC1 |
| InChI | InChI=1S/C19H27N3O2/c1-2-16-8-6-7-11-22(16)19(24)18(23)21-14-12-20(13-15-21)17-9-4-3-5-10-17/h3-5,9-10,16H,2,6-8,11-15H2,1H3 |
| InChIKey | QIZJGLSLJDMMDT-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 43.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.44 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|