C23H30N4O — CID 109173607
(2-ethylpiperidin-1-yl)-[2-(4-phenylpiperazin-1-yl)-4-pyridinyl]methanone (PubChem CID 109173607) has the molecular formula C23H30N4O and a molecular weight of 378.52 g/mol. Its IUPAC name is (2-ethylpiperidin-1-yl)-[2-(4-phenylpiperazin-1-yl)-4-pyridinyl]methanone.
| Compound Name | (2-ethylpiperidin-1-yl)-[2-(4-phenylpiperazin-1-yl)-4-pyridinyl]methanone |
|---|---|
| PubChem CID | 109173607 |
| Molecular Formula | C23H30N4O |
| Molecular Weight | 378.52 g/mol |
| Exact Mass | 378.24 |
| IUPAC Name | (2-ethylpiperidin-1-yl)-[2-(4-phenylpiperazin-1-yl)-4-pyridinyl]methanone |
| SMILES | CCC1CCCCN1C(=O)c1ccnc(N2CCN(c3ccccc3)CC2)c1 |
| InChI | InChI=1S/C23H30N4O/c1-2-20-8-6-7-13-27(20)23(28)19-11-12-24-22(18-19)26-16-14-25(15-17-26)21-9-4-3-5-10-21/h3-5,9-12,18,20H,2,6-8,13-17H2,1H3 |
| InChIKey | IAIXYYXZGDMFLF-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 39.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.52 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |