C13H17NO — CID 20577009
(2-ethylpyrrolidin-1-yl)-phenylmethanone (PubChem CID 20577009) has the molecular formula C13H17NO and a molecular weight of 203.29 g/mol. Its IUPAC name is (2-ethylpyrrolidin-1-yl)-phenylmethanone.
| Compound Name | (2-ethylpyrrolidin-1-yl)-phenylmethanone |
|---|---|
| PubChem CID | 20577009 |
| Molecular Formula | C13H17NO |
| Molecular Weight | 203.29 g/mol |
| Exact Mass | 203.13 |
| IUPAC Name | (2-ethylpyrrolidin-1-yl)-phenylmethanone |
| SMILES | CCC1CCCN1C(=O)c1ccccc1 |
| InChI | InChI=1S/C13H17NO/c1-2-12-9-6-10-14(12)13(15)11-7-4-3-5-8-11/h3-5,7-8,12H,2,6,9-10H2,1H3 |
| InChIKey | HHJFIJSLIAGVDE-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 203.29 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |