C14H19N3O2 — CID 54885605
4-(2-ethylpyrrolidine-1-carbonyl)-N'-hydroxybenzenecarboximidamide (PubChem CID 54885605) has the molecular formula C14H19N3O2 and a molecular weight of 261.32 g/mol. Its IUPAC name is 4-(2-ethylpyrrolidine-1-carbonyl)-N'-hydroxybenzenecarboximidamide.
| Compound Name | 4-(2-ethylpyrrolidine-1-carbonyl)-N'-hydroxybenzenecarboximidamide |
|---|---|
| PubChem CID | 54885605 |
| Molecular Formula | C14H19N3O2 |
| Molecular Weight | 261.32 g/mol |
| Exact Mass | 261.15 |
| IUPAC Name | 4-(2-ethylpyrrolidine-1-carbonyl)-N'-hydroxybenzenecarboximidamide |
| SMILES | CCC1CCCN1C(=O)c1ccc(/C(N)=N/O)cc1 |
| InChI | InChI=1S/C14H19N3O2/c1-2-12-4-3-9-17(12)14(18)11-7-5-10(6-8-11)13(15)16-19/h5-8,12,19H,2-4,9H2,1H3,(H2,15,16) |
| InChIKey | XFANEVYEZHUMHG-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 78.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.32 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|