C22H25NO — CID 6378625
(Z)-1-(2-ethylpiperidin-1-yl)-2,3-diphenylprop-2-en-1-one (PubChem CID 6378625) has the molecular formula C22H25NO and a molecular weight of 319.45 g/mol. Its IUPAC name is (Z)-1-(2-ethylpiperidin-1-yl)-2,3-diphenylprop-2-en-1-one.
| Compound Name | (Z)-1-(2-ethylpiperidin-1-yl)-2,3-diphenylprop-2-en-1-one |
|---|---|
| PubChem CID | 6378625 |
| Molecular Formula | C22H25NO |
| Molecular Weight | 319.45 g/mol |
| Exact Mass | 319.19 |
| IUPAC Name | (Z)-1-(2-ethylpiperidin-1-yl)-2,3-diphenylprop-2-en-1-one |
| SMILES | CCC1CCCCN1C(=O)/C(=C\c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C22H25NO/c1-2-20-15-9-10-16-23(20)22(24)21(19-13-7-4-8-14-19)17-18-11-5-3-6-12-18/h3-8,11-14,17,20H,2,9-10,15-16H2,1H3/b21-17- |
| InChIKey | RNUULRUVXTYOJP-FXBPSFAMSA-N |
| XLogP | 5.02 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.45 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|